ChemNet > CAS > 3034-22-8 2-Amino-5-bromothiazole
3034-22-8 2-Amino-5-bromothiazole
| product Name |
2-Amino-5-bromothiazole |
| CAS No |
3034-22-8 |
| Synonyms |
5-bromo-1,3-thiazol-2-ylamine; (2Z)-5-bromo-2-imino-2,3-dihydro-1,3-thiazol-3-ium bromide; 5-bromo-1,3-thiazol-2-amine |
| Molecular Formula |
C3H3BrN2S |
| Molecular Weight |
179.0383 |
| InChI |
InChI=1/C3H3BrN2S/c4-2-1-6-3(5)7-2/h1H,(H2,5,6) |
| EINECS |
262-699-0 |
| Molecular Structure |
|
| Density |
1.976g/cm3 |
| Melting point |
165℃ |
| Boiling point |
287.6°C at 760 mmHg |
| Refractive index |
1.69 |
| Flash point |
127.7°C |
| Vapour Pressur |
0.00246mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
