ChemNet > CAS > 304477-40-5 1-Methyl-3-phenyl-1H-pyrazole-4-carbaldehyde
304477-40-5 1-Methyl-3-phenyl-1H-pyrazole-4-carbaldehyde
| product Name |
1-Methyl-3-phenyl-1H-pyrazole-4-carbaldehyde |
| CAS No |
304477-40-5 |
| Synonyms |
1-methyl-3-phenyl-1H-Pyrazole-4-carboxaldehyde |
| Molecular Formula |
C11H10N2O |
| Molecular Weight |
186.2099 |
| InChI |
InChI=1/C11H10N2O/c1-13-7-10(8-14)11(12-13)9-5-3-2-4-6-9/h2-8H,1H3 |
| Molecular Structure |
|
| Density |
1.13g/cm3 |
| Melting point |
105℃ |
| Boiling point |
356.4°C at 760 mmHg |
| Refractive index |
1.593 |
| Flash point |
169.4°C |
| Vapour Pressur |
2.92E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
