ChemNet > CAS > 305-15-7 2,5-Dichlorophenylhydrazine
305-15-7 2,5-Dichlorophenylhydrazine
| product Name |
2,5-Dichlorophenylhydrazine |
| CAS No |
305-15-7 |
| Synonyms |
-2,5-DICHLOROPHENYLHYDRAZINE; 1-(2,5-DICHLOROPHENYL)HYDRAZINE; (2,5-dichlorophenyl)-hydrazin; Hydrazine, (2,5-dichlorophenyl)-; 2,5-DICHLOROPHENYLHYRAZINE |
| Molecular Formula |
C6H6Cl2N2 |
| Molecular Weight |
177.0312 |
| InChI |
InChI=1/C6H6Cl2N2/c7-4-1-2-5(8)6(3-4)10-9/h1-3,10H,9H2 |
| EINECS |
206-163-6 |
| Molecular Structure |
|
| Density |
1.475g/cm3 |
| Melting point |
100-104℃ |
| Boiling point |
266.8°C at 760 mmHg |
| Refractive index |
1.665 |
| Flash point |
115.1°C |
| Vapour Pressur |
0.00848mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
