ChemNet > CAS > 3068-88-0 beta-butyrolactone
3068-88-0 beta-butyrolactone
| product Name |
beta-butyrolactone |
| CAS No |
3068-88-0 |
| Synonyms |
Butyrolactone; dl-B-hydroxybutyric acid lactone; 3-Hydroxybutyric acid lactone; 4-Methyl-2-oxetanone; 2-Methyl-beta-propiolactone; dihydrofuran-2(3H)-one; (4R)-4-methyloxetan-2-one; (4S)-4-methyloxetan-2-one; (R)-BETA-BUTYROLACTONE |
| Molecular Formula |
C4H6O2 |
| Molecular Weight |
86.0892 |
| InChI |
InChI=1/C4H6O2/c1-3-2-4(5)6-3/h3H,2H2,1H3/t3-/m0/s1 |
| EINECS |
221-330-3 |
| Molecular Structure |
|
| Density |
1.096g/cm3 |
| Boiling point |
163.2°C at 760 mmHg |
| Refractive index |
1.429 |
| Flash point |
34.1°C |
| Vapour Pressur |
2.09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R45:May cause cancer.;
|
| Safety Description |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
| MSDS |
Material Safety Data Sheet
|
|
