ChemNet > CAS > 306934-87-2 6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde
306934-87-2 6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde
| product Name |
6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde |
| CAS No |
306934-87-2 |
| Synonyms |
6-Fluoro-1,3-benzodioxene-8-carbaldehyde |
| Molecular Formula |
C9H7FO3 |
| Molecular Weight |
182.1485 |
| InChI |
InChI=1/C9H7FO3/c10-8-1-6(3-11)9-7(2-8)4-12-5-13-9/h1-3H,4-5H2 |
| Molecular Structure |
|
| Density |
1.357g/cm3 |
| Melting point |
116℃ |
| Boiling point |
323.051°C at 760 mmHg |
| Refractive index |
1.566 |
| Flash point |
144.319°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
