ChemNet > CAS > 306934-95-2 5-phenyl-2-thienylboronic acid
306934-95-2 5-phenyl-2-thienylboronic acid
| product Name |
5-phenyl-2-thienylboronic acid |
| CAS No |
306934-95-2 |
| Synonyms |
(5-Phenyl-2-thienyl)boronic acid; boronic acid, B-(5-phenyl-2-thienyl)-; (5-phenylthiophen-2-yl)boronic acid; 2-phenythiophen-5-ylboronic acid |
| Molecular Formula |
C10H9BO2S |
| Molecular Weight |
204.0533 |
| InChI |
InChI=1/C10H9BO2S/c12-11(13)10-7-6-9(14-10)8-4-2-1-3-5-8/h1-7,12-13H |
| Molecular Structure |
|
| Density |
1.29g/cm3 |
| Melting point |
146℃ |
| Boiling point |
412.9°C at 760 mmHg |
| Refractive index |
1.632 |
| Flash point |
203.5°C |
| Vapour Pressur |
1.47E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
