ChemNet > CAS > 306934-96-3 5-(2-thienyl)nicotinic acid
306934-96-3 5-(2-thienyl)nicotinic acid
| product Name |
5-(2-thienyl)nicotinic acid |
| CAS No |
306934-96-3 |
| Synonyms |
5-thiophen-2-ylpyridine-3-carboxylic acid |
| Molecular Formula |
C10H7NO2S |
| Molecular Weight |
205.2331 |
| InChI |
InChI=1/C10H7NO2S/c12-10(13)8-4-7(5-11-6-8)9-2-1-3-14-9/h1-6H,(H,12,13) |
| Molecular Structure |
|
| Density |
1.368g/cm3 |
| Melting point |
277℃ |
| Boiling point |
423.8°C at 760 mmHg |
| Refractive index |
1.643 |
| Flash point |
210.1°C |
| Vapour Pressur |
6.12E-08mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
