ChemNet > CAS > 30711-40-1 2-(n-Heptanoyl)thiophene
30711-40-1 2-(n-Heptanoyl)thiophene
| product Name |
2-(n-Heptanoyl)thiophene |
| CAS No |
30711-40-1 |
| Synonyms |
1-(2-Thienoyl)hexane; 1-(thiophen-2-yl)heptan-1-one |
| Molecular Formula |
C11H16OS |
| Molecular Weight |
196.3091 |
| InChI |
InChI=1/C11H16OS/c1-2-3-4-5-7-10(12)11-8-6-9-13-11/h6,8-9H,2-5,7H2,1H3 |
| Molecular Structure |
|
| Density |
1.017g/cm3 |
| Boiling point |
295.9°C at 760 mmHg |
| Refractive index |
1.511 |
| Flash point |
132.7°C |
| Vapour Pressur |
0.00149mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
