ChemNet > CAS > 3075-84-1 2,2',5,5'-Tetramethylbiphenyl
3075-84-1 2,2',5,5'-Tetramethylbiphenyl
| product Name |
2,2',5,5'-Tetramethylbiphenyl |
| CAS No |
3075-84-1 |
| Synonyms |
1,1'-Biphenyl, 2,2',5,5'-tetramethyl- |
| Molecular Formula |
C16H18 |
| Molecular Weight |
210.3141 |
| InChI |
InChI=1/C16H18/c1-11-5-7-13(3)15(9-11)16-10-12(2)6-8-14(16)4/h5-10H,1-4H3 |
| Molecular Structure |
|
| Density |
0.956g/cm3 |
| Boiling point |
282.3°C at 760 mmHg |
| Refractive index |
1.551 |
| Flash point |
124.4°C |
| Vapour Pressur |
0.00577mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
