ChemNet > CAS > 3085-95-8 1,3,5-triazine-2,4,6-triamine, compound with hydrogen peroxide (1:1)
3085-95-8 1,3,5-triazine-2,4,6-triamine, compound with hydrogen peroxide (1:1)
| product Name |
1,3,5-triazine-2,4,6-triamine, compound with hydrogen peroxide (1:1) |
| CAS No |
3085-95-8 |
| Synonyms |
1,3,5-Triazine-2,4,6-triamine, compound with hydrogen peroxide (1:1); hydrogen peroxide - 1,3,5-triazine-2,4,6-triamine (1:1) |
| Molecular Formula |
C3H8N6O2 |
| Molecular Weight |
160.1346 |
| InChI |
InChI=1/C3H6N6.H2O2/c4-1-7-2(5)9-3(6)8-1;1-2/h(H6,4,5,6,7,8,9);1-2H |
| EINECS |
221-405-0 |
| Molecular Structure |
|
| Boiling point |
557.5°C at 760 mmHg |
| Flash point |
325.3°C |
| Vapour Pressur |
1.82E-12mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
