ChemNet > CAS > 3088-42-4 N-(2-Cyanoethyl)glycine
3088-42-4 N-(2-Cyanoethyl)glycine
| product Name |
N-(2-Cyanoethyl)glycine |
| CAS No |
3088-42-4 |
| Synonyms |
N-(2-Cyanoehtyl)glycine |
| Molecular Formula |
C5H8N2O2 |
| Molecular Weight |
128.1292 |
| InChI |
InChI=1/C5H8N2O2/c6-2-1-3-7-4-5(8)9/h7H,1,3-4H2,(H,8,9) |
| EINECS |
221-418-1 |
| Molecular Structure |
|
| Density |
1.187g/cm3 |
| Melting point |
188-193℃ |
| Boiling point |
343.1°C at 760 mmHg |
| Refractive index |
1.473 |
| Flash point |
161.3°C |
| Vapour Pressur |
1.3E-05mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
|
| MSDS |
Material Safety Data Sheet
|
|
