ChemNet > CAS > 3096-57-9 2-Amino-9-fluorenone
3096-57-9 2-Amino-9-fluorenone
| product Name |
2-Amino-9-fluorenone |
| CAS No |
3096-57-9 |
| Synonyms |
Aminofluorenone; 2-amino-9H-fluoren-9-one |
| Molecular Formula |
C13H9NO |
| Molecular Weight |
195.2167 |
| InChI |
InChI=1/C13H9NO/c14-8-5-6-10-9-3-1-2-4-11(9)13(15)12(10)7-8/h1-7H,14H2 |
| EINECS |
221-445-9 |
| Molecular Structure |
|
| Density |
1.327g/cm3 |
| Melting point |
152-157℃ |
| Boiling point |
426.4°C at 760 mmHg |
| Refractive index |
1.72 |
| Flash point |
211.7°C |
| Vapour Pressur |
1.77E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
