ChemNet > CAS > 30991-42-5 o-Cresotic Hydrazide
30991-42-5 o-Cresotic Hydrazide
| product Name |
o-Cresotic Hydrazide |
| CAS No |
30991-42-5 |
| Synonyms |
2-Hydroxy-3-methylbenzhydrazide; 3-Methylsalicylhydrazide; 2-hydroxy-3-methylbenzohydrazide |
| Molecular Formula |
C8H10N2O2 |
| Molecular Weight |
166.1772 |
| InChI |
InChI=1/C8H10N2O2/c1-5-3-2-4-6(7(5)11)8(12)10-9/h2-4,11H,9H2,1H3,(H,10,12) |
| Molecular Structure |
|
| Density |
1.262g/cm3 |
| Refractive index |
1.607 |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
