ChemNet > CAS > 3113-72-2 5-methyl-2-nitrobenzoic acid
3113-72-2 5-methyl-2-nitrobenzoic acid
| product Name |
5-methyl-2-nitrobenzoic acid |
| CAS No |
3113-72-2 |
| Synonyms |
6-Nitro-m-toluic acid; 2-Nitro-5-Methylbenzoicacid; 2-Nitro-5-methylbenzoic acid |
| Molecular Formula |
C8H7NO4 |
| Molecular Weight |
181.1455 |
| InChI |
InChI=1/C8H7NO4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11) |
| EINECS |
221-481-5 |
| Molecular Structure |
|
| Density |
1.392g/cm3 |
| Melting point |
134-136℃ |
| Boiling point |
367.6°C at 760 mmHg |
| Refractive index |
1.6 |
| Flash point |
166.8°C |
| Vapour Pressur |
4.72E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
