ChemNet > CAS > 3125-71-1 3-Acetylphenyl isothiocyanate
3125-71-1 3-Acetylphenyl isothiocyanate
| product Name |
3-Acetylphenyl isothiocyanate |
| CAS No |
3125-71-1 |
| Synonyms |
3-Isothiocyanatoacetophenone; 1-(3-isothiocyanatophenyl)ethanone |
| Molecular Formula |
C9H7NOS |
| Molecular Weight |
177.223 |
| InChI |
InChI=1/C9H7NOS/c1-7(11)8-3-2-4-9(5-8)10-6-12/h2-5H,1H3 |
| Molecular Structure |
|
| Density |
1.11g/cm3 |
| Boiling point |
324.4°C at 760 mmHg |
| Refractive index |
1.576 |
| Flash point |
150°C |
| Vapour Pressur |
0.000247mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
