ChemNet > CAS > 3125-78-8 3-cyanophenyl isothiocyanate
3125-78-8 3-cyanophenyl isothiocyanate
| product Name |
3-cyanophenyl isothiocyanate |
| CAS No |
3125-78-8 |
| Synonyms |
3-Isothiocyanatobenzonitrile |
| Molecular Formula |
C8H4N2S |
| Molecular Weight |
160.1958 |
| InChI |
InChI=1/C8H4N2S/c9-5-7-2-1-3-8(4-7)10-6-11/h1-4H |
| Molecular Structure |
|
| Density |
1.12g/cm3 |
| Melting point |
64-66℃ |
| Boiling point |
303.1°C at 760 mmHg |
| Refractive index |
1.604 |
| Flash point |
137.1°C |
| Vapour Pressur |
0.000953mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
