ChemNet > CAS > 31252-42-3 4-Benzylpiperidine
31252-42-3 4-Benzylpiperidine
| product Name |
4-Benzylpiperidine |
| CAS No |
31252-42-3 |
| Synonyms |
4-(Phenylmethyl)piperidine; 4-benzylpiperidinium; 4-Benzyl piperidine |
| Molecular Formula |
C12H18N |
| Molecular Weight |
176.2775 |
| InChI |
InChI=1/C12H17N/c1-2-4-11(5-3-1)10-12-6-8-13-9-7-12/h1-5,12-13H,6-10H2/p+1 |
| EINECS |
250-535-0 |
| Molecular Structure |
|
| Melting point |
6-7℃ |
| Boiling point |
279.6°C at 760 mmHg |
| Flash point |
125.4°C |
| Vapour Pressur |
0.00397mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
