ChemNet > CAS > 3138-86-1 2,3-Bis(bromomethyl)quinoxaline
3138-86-1 2,3-Bis(bromomethyl)quinoxaline
| product Name |
2,3-Bis(bromomethyl)quinoxaline |
| CAS No |
3138-86-1 |
| Synonyms |
2,3-Bis-(bromethyl)-quinoxaline 98% |
| Molecular Formula |
C10H8Br2N2 |
| Molecular Weight |
315.9919 |
| InChI |
InChI=1/C10H8Br2N2/c11-5-9-10(6-12)14-8-4-2-1-3-7(8)13-9/h1-4H,5-6H2 |
| EINECS |
221-538-4 |
| Molecular Structure |
|
| Density |
1.869g/cm3 |
| Melting point |
150-154℃ |
| Boiling point |
345.7°C at 760 mmHg |
| Refractive index |
1.703 |
| Flash point |
162.9°C |
| Vapour Pressur |
0.000121mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
| MSDS |
Material Safety Data Sheet
|
|
