ChemNet > CAS > 3141-25-1 2,3,4-Tribromothiophene
3141-25-1 2,3,4-Tribromothiophene
| product Name |
2,3,4-Tribromothiophene |
| CAS No |
3141-25-1 |
| Molecular Formula |
C4HBr3S |
| Molecular Weight |
320.8277 |
| InChI |
InChI=1/C4HBr3S/c5-2-1-8-4(7)3(2)6/h1H |
| EINECS |
221-545-2 |
| Molecular Structure |
|
| Density |
2.516g/cm3 |
| Boiling point |
277.5°C at 760 mmHg |
| Refractive index |
1.671 |
| Flash point |
121.6°C |
| Vapour Pressur |
0.00762mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
