ChemNet > CAS > 3141-93-3 1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one
3141-93-3 1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one
| product Name |
1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one |
| CAS No |
3141-93-3 |
| Synonyms |
1-(3,4-dimethoxyphenyl)-2-phenylethanone |
| Molecular Formula |
C16H16O3 |
| Molecular Weight |
256.2964 |
| InChI |
InChI=1/C16H16O3/c1-18-15-9-8-13(11-16(15)19-2)14(17)10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.115g/cm3 |
| Melting point |
87℃ |
| Boiling point |
398°C at 760 mmHg |
| Refractive index |
1.558 |
| Flash point |
186.1°C |
| Vapour Pressur |
1.53E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
