ChemNet > CAS > 3147-62-4 3,5-Dihydroxybenzamide
3147-62-4 3,5-Dihydroxybenzamide
| product Name |
3,5-Dihydroxybenzamide |
| CAS No |
3147-62-4 |
| Synonyms |
3,5-Dihydroxy Benzomide; 3,5-Dihydroxy-Benzamide |
| Molecular Formula |
C7H7NO3 |
| Molecular Weight |
153.1354 |
| InChI |
InChI=1/C7H7NO3/c8-7(11)4-1-5(9)3-6(10)2-4/h1-3,9-10H,(H2,8,11) |
| EINECS |
221-571-4 |
| Molecular Structure |
|
| Density |
1.458g/cm3 |
| Boiling point |
452.4°C at 760 mmHg |
| Refractive index |
1.664 |
| Flash point |
227.4°C |
| Vapour Pressur |
8.43E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
