ChemNet > CAS > 31545-26-3 4-Chloro-3-nitrophenyl cyclopropyl ketone
31545-26-3 4-Chloro-3-nitrophenyl cyclopropyl ketone
| product Name |
4-Chloro-3-nitrophenyl cyclopropyl ketone |
| CAS No |
31545-26-3 |
| Synonyms |
(4-chloro-3-nitrophenyl)(cyclopropyl)methanone |
| Molecular Formula |
C10H8ClNO3 |
| Molecular Weight |
225.6284 |
| InChI |
InChI=1/C10H8ClNO3/c11-8-4-3-7(5-9(8)12(14)15)10(13)6-1-2-6/h3-6H,1-2H2 |
| EINECS |
250-690-4 |
| Molecular Structure |
|
| Density |
1.464g/cm3 |
| Melting point |
78-80℃ |
| Boiling point |
333.4°C at 760 mmHg |
| Refractive index |
1.631 |
| Flash point |
155.4°C |
| Vapour Pressur |
0.000137mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
