ChemNet > CAS > 3156-41-0 beta,4-Dinitrostyrene
3156-41-0 beta,4-Dinitrostyrene
| product Name |
beta,4-Dinitrostyrene |
| CAS No |
3156-41-0 |
| Synonyms |
2-Nitro-1-(4-nitrophenyl)ethene~4-Nitro-beta-nitrostyrene; 1-nitro-4-[(E)-2-nitroethenyl]benzene |
| Molecular Formula |
C8H6N2O4 |
| Molecular Weight |
194.1442 |
| InChI |
InChI=1/C8H6N2O4/c11-9(12)6-5-7-1-3-8(4-2-7)10(13)14/h1-6H/b6-5+ |
| Molecular Structure |
|
| Density |
1.401g/cm3 |
| Boiling point |
320°C at 760 mmHg |
| Refractive index |
1.642 |
| Flash point |
156.9°C |
| Vapour Pressur |
0.00061mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
