ChemNet > CAS > 31736-73-9 4'-Bromo-3-chloropropiophenone
31736-73-9 4'-Bromo-3-chloropropiophenone
| product Name |
4'-Bromo-3-chloropropiophenone |
| CAS No |
31736-73-9 |
| Synonyms |
4-Bromo-beta-chloropropiophenone; 1-(4-bromophenyl)-3-chloropropan-1-one |
| Molecular Formula |
C7H4BrClO2 |
| Molecular Weight |
235.4625 |
| InChI |
InChI=1/C7H4BrClO2/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H,10,11) |
| EINECS |
250-784-5 |
| Molecular Structure |
|
| Density |
1.809g/cm3 |
| Melting point |
58-61℃ |
| Boiling point |
347.4°C at 760 mmHg |
| Refractive index |
1.621 |
| Flash point |
163.9°C |
| Vapour Pressur |
2.04E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
