ChemNet > CAS > 3187-19-7 2-Hydroxy-4,6-dimethoxybenzoic acid
3187-19-7 2-Hydroxy-4,6-dimethoxybenzoic acid
| product Name |
2-Hydroxy-4,6-dimethoxybenzoic acid |
| CAS No |
3187-19-7 |
| Synonyms |
4,6-Dimethoxy-2-hydroxybenzoic acid~4,6-Dimethoxysalicylic acid |
| Molecular Formula |
C9H10O5 |
| Molecular Weight |
198.1727 |
| InChI |
InChI=1/C9H10O5/c1-13-5-3-6(10)8(9(11)12)7(4-5)14-2/h3-4,10H,1-2H3,(H,11,12) |
| EINECS |
221-683-3 |
| Molecular Structure |
|
| Density |
1.335g/cm3 |
| Boiling point |
371°C at 760 mmHg |
| Refractive index |
1.566 |
| Flash point |
151.1°C |
| Vapour Pressur |
3.68E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
