ChemNet > CAS > 31874-34-7 2,4-Dimethoxybenzaldoxime
31874-34-7 2,4-Dimethoxybenzaldoxime
| product Name |
2,4-Dimethoxybenzaldoxime |
| CAS No |
31874-34-7 |
| Synonyms |
1-(2,4-dimethoxyphenyl)-N-hydroxymethanimine; 2,4-dimethoxybenzaldehyde oxime |
| Molecular Formula |
C9H11NO3 |
| Molecular Weight |
181.1885 |
| InChI |
InChI=1/C9H11NO3/c1-12-8-4-3-7(6-10-11)9(5-8)13-2/h3-6,11H,1-2H3/b10-6+ |
| Molecular Structure |
|
| Density |
1.11g/cm3 |
| Boiling point |
304.9°C at 760 mmHg |
| Refractive index |
1.501 |
| Flash point |
138.2°C |
| Vapour Pressur |
0.000372mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
