ChemNet > CAS > 31909-58-7 2-Furoylacetonitrile
31909-58-7 2-Furoylacetonitrile
| product Name |
2-Furoylacetonitrile |
| CAS No |
31909-58-7 |
| Synonyms |
3-(furan-2-yl)-3-oxopropanenitrile |
| Molecular Formula |
C7H5NO2 |
| Molecular Weight |
135.1201 |
| InChI |
InChI=1/C7H5NO2/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5H,3H2 |
| Molecular Structure |
|
| Density |
1.188g/cm3 |
| Melting point |
76-83℃ |
| Boiling point |
297.2°C at 760 mmHg |
| Refractive index |
1.494 |
| Flash point |
133.6°C |
| Vapour Pressur |
0.00137mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
