ChemNet > CAS > 31928-47-9 4-Bromo-2-chloro-1-iodobenzene
31928-47-9 4-Bromo-2-chloro-1-iodobenzene
| product Name |
4-Bromo-2-chloro-1-iodobenzene |
| CAS No |
31928-47-9 |
| Synonyms |
4-Bromo-2-chloroiodobenzene; 1-Bromo-3-chloro-4-iodobenzene |
| Molecular Formula |
C6H3BrClI |
| Molecular Weight |
317.3495 |
| InChI |
InChI=1/C6H3BrClI/c7-4-1-2-6(9)5(8)3-4/h1-3H |
| Molecular Structure |
|
| Density |
2.272g/cm3 |
| Boiling point |
281.2°C at 760 mmHg |
| Refractive index |
1.663 |
| Flash point |
123.8°C |
| Vapour Pressur |
0.00617mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
