ChemNet > CAS > 31949-21-0 2-Bromo-2'-Methoxy Acetophenone
31949-21-0 2-Bromo-2'-Methoxy Acetophenone
| product Name |
2-Bromo-2'-Methoxy Acetophenone |
| CAS No |
31949-21-0 |
| Synonyms |
bromomethyl 2-methoxyphenyl ketone; 2-Bromo-2?Methoxy Acetophenone; 2-Bromo-2-Methoxyacetophenone; alpha-Bromo-2'-methoxyacetophenone; 2-bromo-1-(2-methoxyphenyl)ethanone; 2-Bromo-2’-methoxy acetophenone; 2-Bromo-2'-methoxyacetophenone |
| Molecular Formula |
C9H9BrO2 |
| Molecular Weight |
229.0706 |
| InChI |
InChI=1/C9H9BrO2/c1-12-9-5-3-2-4-7(9)8(11)6-10/h2-5H,6H2,1H3 |
| EINECS |
250-870-2 |
| Molecular Structure |
|
| Density |
1.448g/cm3 |
| Melting point |
43-45℃ |
| Boiling point |
323.7°C at 760 mmHg |
| Refractive index |
1.554 |
| Flash point |
123.2°C |
| Vapour Pressur |
0.000257mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
