ChemNet > CAS > 3198-15-0 Norephedrine hydrochloride
3198-15-0 Norephedrine hydrochloride
| product Name |
Norephedrine hydrochloride |
| CAS No |
3198-15-0 |
| Synonyms |
Phenylpropanolamine hydrochloride; 2-Amino-1-phenyl-1-propanol hydrochloride; 2-amino-1-phenylpropan-1-ol |
| Molecular Formula |
C9H13NO |
| Molecular Weight |
151.2056 |
| InChI |
InChI=1/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3 |
| EINECS |
221-702-5 |
| Molecular Structure |
|
| Density |
1.071g/cm3 |
| Melting point |
194-197℃ |
| Boiling point |
288.1°C at 760 mmHg |
| Refractive index |
1.557 |
| Flash point |
128.1°C |
| Vapour Pressur |
0.0011mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
|
