ChemNet > CAS > 3199-44-8 Thiophene-3-carboxaldehyde diethyl acetal
3199-44-8 Thiophene-3-carboxaldehyde diethyl acetal
| product Name |
Thiophene-3-carboxaldehyde diethyl acetal |
| CAS No |
3199-44-8 |
| Synonyms |
3-(diethoxymethyl)thiophene |
| Molecular Formula |
C9H14O2S |
| Molecular Weight |
186.2713 |
| InChI |
InChI=1/C9H14O2S/c1-3-10-9(11-4-2)8-5-6-12-7-8/h5-7,9H,3-4H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.066g/cm3 |
| Boiling point |
222.8°C at 760 mmHg |
| Refractive index |
1.502 |
| Flash point |
88.5°C |
| Vapour Pressur |
0.148mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
