ChemNet > CAS > 320-65-0 2-fluorobenzal chloride
320-65-0 2-fluorobenzal chloride
| product Name |
2-fluorobenzal chloride |
| CAS No |
320-65-0 |
| Synonyms |
alpha,alpha-Dichloro-2-fluorotoluene |
| Molecular Formula |
C7H5Cl2F |
| Molecular Weight |
179.02
|
| InChI |
InChI=1/C7H5Cl2F/c8-7(9)5-3-1-2-4-6(5)10/h1-4,7H |
| EINECS |
206-279-7 |
| Molecular Structure |
|
| Density |
1.3 |
| Boiling point |
224℃ |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
