ChemNet > CAS > 3209-72-1 ethyl 5-methylisoxazole-3-carboxylate
3209-72-1 ethyl 5-methylisoxazole-3-carboxylate
| product Name |
ethyl 5-methylisoxazole-3-carboxylate |
| CAS No |
3209-72-1 |
| Synonyms |
5-methylisoxazole-3-carboxylate ethyl; ethyl 5-methyl-1,2-oxazole-3-carboxylate |
| Molecular Formula |
C7H9NO3 |
| Molecular Weight |
155.1513 |
| InChI |
InChI=1/C7H9NO3/c1-3-10-7(9)6-4-5(2)11-8-6/h4H,3H2,1-2H3 |
| EINECS |
221-720-3 |
| Molecular Structure |
|
| Density |
1.139g/cm3 |
| Melting point |
25℃ |
| Boiling point |
246.2°C at 760 mmHg |
| Refractive index |
1.468 |
| Flash point |
102.7°C |
| Vapour Pressur |
0.0275mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
