ChemNet > CAS > 3215-65-4 2,3,6-Trichlorophenylacetonitrile
3215-65-4 2,3,6-Trichlorophenylacetonitrile
| product Name |
2,3,6-Trichlorophenylacetonitrile |
| CAS No |
3215-65-4 |
| Synonyms |
2,3,6-Trichlorobenzyl cyanide |
| Molecular Formula |
C8H4Cl3N |
| Molecular Weight |
220.4831 |
| InChI |
InChI=1/C8H4Cl3N/c9-6-1-2-7(10)8(11)5(6)3-4-12/h1-2H,3H2 |
| EINECS |
221-731-3 |
| Molecular Structure |
|
| Density |
1.455g/cm3 |
| Boiling point |
316.9°C at 760 mmHg |
| Refractive index |
1.579 |
| Flash point |
138.2°C |
| Vapour Pressur |
0.000398mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
