ChemNet > CAS > 322-46-3 Pyrido[2,3-b]pyrazine
322-46-3 Pyrido[2,3-b]pyrazine
| product Name |
Pyrido[2,3-b]pyrazine |
| CAS No |
322-46-3 |
| Synonyms |
1,4,5-Triazanaphthalene; Pyrido(2,3-b)pyrazine; Pyridopyrazine |
| Molecular Formula |
C7H5N3 |
| Molecular Weight |
131.1347 |
| InChI |
InChI=1/C7H5N3/c1-2-6-7(9-3-1)10-5-4-8-6/h1-5H |
| EINECS |
206-294-9 |
| Molecular Structure |
![322-46-3 Pyrido[2,3-b]pyrazine](https://images-a.chemnet.com/suppliers/chembase/309/3093.gif)
|
| Density |
1.27g/cm3 |
| Melting point |
139-143℃ |
| Boiling point |
253.9°C at 760 mmHg |
| Refractive index |
1.665 |
| Flash point |
115.9°C |
| Vapour Pressur |
0.0284mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
