ChemNet > CAS > 32358-91-1 5-Propionyl-2,2'-bithienyl
32358-91-1 5-Propionyl-2,2'-bithienyl
| product Name |
5-Propionyl-2,2'-bithienyl |
| CAS No |
32358-91-1 |
| Synonyms |
1-(2,2-Bithiophen-5-yl)propan-1-one |
| Molecular Formula |
C11H10OS2 |
| Molecular Weight |
222.3265 |
| InChI |
InChI=1/C11H10OS2/c1-2-8(12)9-5-6-11(14-9)10-4-3-7-13-10/h3-7H,2H2,1H3 |
| Molecular Structure |
|
| Density |
1.223g/cm3 |
| Boiling point |
373.7°C at 760 mmHg |
| Refractive index |
1.601 |
| Flash point |
179.8°C |
| Vapour Pressur |
8.78E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
