ChemNet > CAS > 32477-35-3 heptafluorobutyrylimidazole
32477-35-3 heptafluorobutyrylimidazole
| product Name |
heptafluorobutyrylimidazole |
| CAS No |
32477-35-3 |
| Synonyms |
N-Heptafluorobutyrylimidazole; 4'-fluorobiphenyl-4-amine hydrochloride (1:1) |
| Molecular Formula |
C12H11ClFN |
| Molecular Weight |
223.6738 |
| InChI |
InChI=1/C12H10FN.ClH/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;/h1-8H,14H2;1H |
| EINECS |
251-063-8 |
| Molecular Structure |
|
| Boiling point |
306.6°C at 760 mmHg |
| Flash point |
158°C |
| Vapour Pressur |
0.000762mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
