ChemNet > CAS > 32556-71-1 (S)-1-Octyn-3-ol
32556-71-1 (S)-1-Octyn-3-ol
| product Name |
(S)-1-Octyn-3-ol |
| CAS No |
32556-71-1 |
| Synonyms |
Octynol; (S)-(-)-1-Octyn-3-ol; (3S)-oct-1-yn-3-ol |
| Molecular Formula |
C8H14O |
| Molecular Weight |
126.1962 |
| InChI |
InChI=1/C8H14O/c1-3-5-6-7-8(9)4-2/h2,8-9H,3,5-7H2,1H3/t8-/m1/s1 |
| EINECS |
212-455-4 |
| Molecular Structure |
|
| Density |
0.887g/cm3 |
| Boiling point |
169.6°C at 760 mmHg |
| Refractive index |
1.452 |
| Flash point |
63.9°C |
| Vapour Pressur |
0.496mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
