ChemNet > CAS > 3259-03-8 2-(2-Ethoxyphenoxy)ethyl bromide
3259-03-8 2-(2-Ethoxyphenoxy)ethyl bromide
| product Name |
2-(2-Ethoxyphenoxy)ethyl bromide |
| CAS No |
3259-03-8 |
| Synonyms |
2-(2-ethoxyphenoxy)bromide ethane; 5-(2-oxypropyl)-2-methoxybenzene sulphonamide; 1-(2-bromoethoxy)-2-ethoxybenzene; 2-(2-ethoxyphenoxy) bromide ethane |
| Molecular Formula |
C10H13BrO2 |
| Molecular Weight |
245.113 |
| InChI |
InChI=1/C10H13BrO2/c1-2-12-9-5-3-4-6-10(9)13-8-7-11/h3-6H,2,7-8H2,1H3 |
| Molecular Structure |
|
| Density |
1.334g/cm3 |
| Boiling point |
286.9°C at 760 mmHg |
| Refractive index |
1.528 |
| Flash point |
119.2°C |
| Vapour Pressur |
0.00442mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
