ChemNet > CAS > 3260-88-6 3-Chloro-2-methylanisole,98%
3260-88-6 3-Chloro-2-methylanisole,98%
| product Name |
3-Chloro-2-methylanisole,98% |
| CAS No |
3260-88-6 |
| Synonyms |
3-Chloro-2-methylanisole; 2-Chloro-6-methoxytoluene~2-Methoxy-6-chlorotoluene; 1-chloro-3-methoxy-2-methylbenzene |
| Molecular Formula |
C8H9ClO |
| Molecular Weight |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c1-6-7(9)4-3-5-8(6)10-2/h3-5H,1-2H3 |
| EINECS |
221-862-6 |
| Molecular Structure |
|
| Density |
1.105g/cm3 |
| Boiling point |
201.9°C at 760 mmHg |
| Refractive index |
1.514 |
| Flash point |
82.1°C |
| Vapour Pressur |
0.427mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
