ChemNet > CAS > 3278-35-1 diethyl thiodicarbonate
3278-35-1 diethyl thiodicarbonate
| product Name |
diethyl thiodicarbonate |
| CAS No |
3278-35-1 |
| Synonyms |
Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), OC,OC'-diethyl ester; AI3-19742; Ethyl xanthogen ethyl formate; NSC 403191; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiocarbonate; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiolcarbonate; Carbonic acid, dithio-, anhydrosulfide with O-ethyl thiocarbonate, O-ethyl ester (8CI); Diethyl thiodicarbonate ((OH)C(O)SC(S)(OH)); Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), diethyl ester; Thiodicarbonic acid, diethyl ester; O,O-diethyl dithiodicarbonate |
| Molecular Formula |
C6H10O3S2 |
| Molecular Weight |
194.2718 |
| InChI |
InChI=1/C6H10O3S2/c1-3-8-5(7)11-6(10)9-4-2/h3-4H2,1-2H3 |
| EINECS |
221-911-1 |
| Molecular Structure |
|
| Density |
1.242g/cm3 |
| Boiling point |
236°C at 760 mmHg |
| Refractive index |
1.534 |
| Flash point |
96.5°C |
| Vapour Pressur |
0.0487mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
