ChemNet > CAS > 32890-89-4 2-Chloro-6-fluoro-3-methylbenzoic acid
32890-89-4 2-Chloro-6-fluoro-3-methylbenzoic acid
| product Name |
2-Chloro-6-fluoro-3-methylbenzoic acid |
| CAS No |
32890-89-4 |
| Synonyms |
2-Chloro-6-fluoro-m-toluic acid |
| Molecular Formula |
C8H6ClFO2 |
| Molecular Weight |
188.5834 |
| InChI |
InChI=1/C8H6ClFO2/c1-4-2-3-5(10)6(7(4)9)8(11)12/h2-3H,1H3,(H,11,12) |
| Molecular Structure |
|
| Density |
1.403g/cm3 |
| Boiling point |
278.1°C at 760 mmHg |
| Refractive index |
1.551 |
| Flash point |
122°C |
| Vapour Pressur |
0.00209mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
