ChemNet > CAS > 3291-03-0 3,4,5-Trimethoxybenzhydrazide
3291-03-0 3,4,5-Trimethoxybenzhydrazide
| product Name |
3,4,5-Trimethoxybenzhydrazide |
| CAS No |
3291-03-0 |
| Synonyms |
3,4,5-Trimethoxybenzohydrazide |
| Molecular Formula |
C10H14N2O4 |
| Molecular Weight |
226.2292 |
| InChI |
InChI=1/C10H14N2O4/c1-14-7-4-6(10(13)12-11)5-8(15-2)9(7)16-3/h4-5H,11H2,1-3H3,(H,12,13) |
| EINECS |
221-954-6 |
| Molecular Structure |
|
| Density |
1.197g/cm3 |
| Refractive index |
1.534 |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
