ChemNet > CAS > 33018-91-6 Monoethylpimelate
33018-91-6 Monoethylpimelate
| product Name |
Monoethylpimelate |
| CAS No |
33018-91-6 |
| Synonyms |
Ethyl hydrogen pimelate; Heptanedioic acid monoethyl ester; Monoethyl pimelate; Pimelic acid monoethyl ester; Ethylhydrogenpimelate; Pimelicacidmonoethylester; 7-ethoxy-7-oxoheptanoic acid; Boc-His(Tos)-Merrifield resin |
| Molecular Formula |
C9H16O4 |
| Molecular Weight |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-2-13-9(12)7-5-3-4-6-8(10)11/h2-7H2,1H3,(H,10,11) |
| EINECS |
251-346-6 |
| Molecular Structure |
|
| Density |
1.074g/cm3 |
| Boiling point |
288.7°C at 760 mmHg |
| Refractive index |
1.449 |
| Flash point |
108°C |
| Vapour Pressur |
0.000581mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
