33018-91-6 Monoethylpimelate
product Name |
Monoethylpimelate |
CAS No |
33018-91-6 |
Synonyms |
Ethyl hydrogen pimelate; Heptanedioic acid monoethyl ester; Monoethyl pimelate; Pimelic acid monoethyl ester; Ethylhydrogenpimelate; Pimelicacidmonoethylester; 7-ethoxy-7-oxoheptanoic acid; Boc-His(Tos)-Merrifield resin |
Molecular Formula |
C9H16O4 |
Molecular Weight |
188.2209 |
InChI |
InChI=1/C9H16O4/c1-2-13-9(12)7-5-3-4-6-8(10)11/h2-7H2,1H3,(H,10,11) |
EINECS |
251-346-6 |
Molecular Structure |
|
Density |
1.074g/cm3 |
Boiling point |
288.7°C at 760 mmHg |
Refractive index |
1.449 |
Flash point |
108°C |
Vapour Pressur |
0.000581mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|