ChemNet > CAS > 3314-35-0 3-Amino-4,5-dihydro-1-phenylpyrazole
3314-35-0 3-Amino-4,5-dihydro-1-phenylpyrazole
| product Name |
3-Amino-4,5-dihydro-1-phenylpyrazole |
| CAS No |
3314-35-0 |
| Synonyms |
3-Amino-1-phenyl-2-pyrazoline; 1-phenyl-4,5-dihydro-1H-pyrazol-3-amine |
| Molecular Formula |
C9H11N3 |
| Molecular Weight |
161.2037 |
| InChI |
InChI=1/C9H11N3/c10-9-6-7-12(11-9)8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,10,11) |
| EINECS |
222-005-9 |
| Molecular Structure |
|
| Density |
1.21g/cm3 |
| Boiling point |
291.2°C at 760 mmHg |
| Refractive index |
1.641 |
| Flash point |
129.9°C |
| Vapour Pressur |
0.00197mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36:Irritating to eyes.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
