ChemNet > CAS > 33155-90-7 Hydroxybenzoquinoline
33155-90-7 Hydroxybenzoquinoline
| product Name |
Hydroxybenzoquinoline |
| CAS No |
33155-90-7 |
| Synonyms |
10-Hydroxybenzo[h]quinoline; benzo[h]quinolin-10-ol |
| Molecular Formula |
C13H9NO |
| Molecular Weight |
195.2167 |
| InChI |
InChI=1/C13H9NO/c15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11/h1-8,15H |
| Molecular Structure |
|
| Density |
1.307g/cm3 |
| Boiling point |
420.621°C at 760 mmHg |
| Refractive index |
1.768 |
| Flash point |
208.184°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
