ChemNet > CAS > 3319-01-5 1-Cyclohexylpiperidine
3319-01-5 1-Cyclohexylpiperidine
| product Name |
1-Cyclohexylpiperidine |
| CAS No |
3319-01-5 |
| Synonyms |
1-Piperidinocyclohexane; N-cyclohexylpiperidine |
| Molecular Formula |
C11H21N |
| Molecular Weight |
167.2911 |
| InChI |
InChI=1/C11H21N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h11H,1-10H2 |
| EINECS |
222-016-9 |
| Molecular Structure |
|
| Density |
0.941g/cm3 |
| Boiling point |
234.3°C at 760 mmHg |
| Refractive index |
1.501 |
| Flash point |
101.4°C |
| Vapour Pressur |
0.0531mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
