ChemNet > CAS > 3319-15-1 4-Methoxy-alpha-methylbenzyl alcohol
3319-15-1 4-Methoxy-alpha-methylbenzyl alcohol
| product Name |
4-Methoxy-alpha-methylbenzyl alcohol |
| CAS No |
3319-15-1;74587-18-1 |
| Synonyms |
4-Methoxyphenyl methyl carbinol; ALPHA-Methyl-p-anisyl alcohol; 1-(4-methoxyphenyl)ethanol; (1R)-1-(4-methoxyphenyl)ethanol |
| Molecular Formula |
C9H12O2 |
| Molecular Weight |
152.1904 |
| InChI |
InChI=1/C9H12O2/c1-7(10)8-3-5-9(11-2)6-4-8/h3-7,10H,1-2H3/t7-/m1/s1 |
| EINECS |
222-019-5 |
| Molecular Structure |
|
| Density |
1.053g/cm3 |
| Boiling point |
254.3°C at 760 mmHg |
| Refractive index |
1.521 |
| Flash point |
108°C |
| Vapour Pressur |
0.00899mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
