ChemNet > CAS > 332-77-4 2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans
332-77-4 2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans
| product Name |
2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans |
| Synonyms |
2,5-Dihydro-2,5-dimethoxyfuran; 2,5-Dimethoxy-2,5-dihydrofuran; (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran; (2R,5S)-2,5-dimethoxy-2,5-dihydrofuran; (2S,5S)-2,5-dimethoxy-2,5-dihydrofuran |
| Molecular Formula |
C6H10O3 |
| Molecular Weight |
130.1418 |
| InChI |
InChI=1/C6H10O3/c1-7-5-3-4-6(8-2)9-5/h3-6H,1-2H3/t5-,6-/m0/s1 |
| CAS Registry Number |
332-77-4 |
| EINECS |
206-367-5 |
| Molecular Structure |
|
| Density |
1.06g/cm3 |
| Boiling point |
161°C at 760 mmHg |
| Refractive index |
1.448 |
| Flash point |
47.2°C |
| Vapour Pressur |
3.02mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R10:;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
| MSDS |
2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans Material Safety Data Sheet
|
|
