ChemNet > CAS > 3320-90-9 2,5-diethoxytetrahydrofuran, mixture of isom
3320-90-9 2,5-diethoxytetrahydrofuran, mixture of isom
| product Name |
2,5-diethoxytetrahydrofuran, mixture of isom |
| CAS No |
3320-90-9 |
| Synonyms |
2,5-diethoxytetrahydrofuran |
| Molecular Formula |
C8H16O3 |
| Molecular Weight |
160.2108 |
| InChI |
InChI=1/C8H16O3/c1-3-9-7-5-6-8(11-7)10-4-2/h7-8H,3-6H2,1-2H3 |
| EINECS |
222-026-3 |
| Molecular Structure |
|
| Density |
0.98g/cm3 |
| Boiling point |
173.1°C at 760 mmHg |
| Refractive index |
1.432 |
| Flash point |
56.7°C |
| Vapour Pressur |
1.72mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
